Products 3077185-45-3
CAS 3077185-45-3 is the registry number for Eltrombopag ethyl ester. Offered by: Sigma-Aldrich. Available pack sizes: 25MG.
Ethyl 3-[3-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-2-hydroxyphenyl]benzoate (CAS 3077185-45-3) is a chemical compound with the molecular formula C27H26N4O4 and a molecular weight of 470.5 g/mol. IUPAC name: ethyl 3-[3-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-2-hydroxyphenyl]benzoate. InChIKey: LTEOVAGPERLLOQ-UHFFFAOYSA-N.
| Molecular formula | C27H26N4O4 |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | ethyl 3-[3-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-2-hydroxyphenyl]benzoate |
| InChIKey | LTEOVAGPERLLOQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC(=C1)C2=C(C(=CC=C2)N=NC3=C(NN(C3=O)C4=CC(=C(C=C4)C)C)C)O |
Computed by PubChem (NCBI)
Synonyms:
Eltrombopag Ethyl Ester, Eltrombopag Impurity O