CAS 3077254-39-5 is the registry number for CYP1B1-IN-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3-chlorophenyl)-N-(3,5-dichlorophenyl)-1,3-thiazole-2-carboxamide (CAS 3077254-39-5) is a chemical compound with the molecular formula C16H9Cl3N2OS and a molecular weight of 383.7 g/mol. IUPAC name: 4-(3-chlorophenyl)-N-(3,5-dichlorophenyl)-1,3-thiazole-2-carboxamide. InChIKey: UYAZEIAQRTVQME-UHFFFAOYSA-N.
| Molecular formula | C16H9Cl3N2OS |
|---|---|
| Molecular weight | 383.7 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-N-(3,5-dichlorophenyl)-1,3-thiazole-2-carboxamide |
| InChIKey | UYAZEIAQRTVQME-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CSC(=N2)C(=O)NC3=CC(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)