CAS 3077430-87-3 is the registry number for Androgen receptor ligand 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-fluoro-4-[4-(4-hydroxyphenyl)piperidin-1-yl]-2-(trifluoromethyl)benzonitrile (CAS 3077430-87-3) is a chemical compound with the molecular formula C19H16F4N2O and a molecular weight of 364.3 g/mol. IUPAC name: 3-fluoro-4-[4-(4-hydroxyphenyl)piperidin-1-yl]-2-(trifluoromethyl)benzonitrile. InChIKey: FQIMFYUFVBAQCE-UHFFFAOYSA-N.
| Molecular formula | C19H16F4N2O |
|---|---|
| Molecular weight | 364.3 g/mol |
| IUPAC name | 3-fluoro-4-[4-(4-hydroxyphenyl)piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| InChIKey | FQIMFYUFVBAQCE-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C2=CC=C(C=C2)O)C3=C(C(=C(C=C3)C#N)C(F)(F)F)F |
Computed by PubChem (NCBI)