CAS 3077720-24-9 is the registry number for NRG1271, 98.86%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 5 mg, 10 mg, 50 mg.
(Z)-2-fluoro-N-(5-fluoro-2,4-dimethyl-3-pyridinyl)-3-(7-fluoro-1H-indazol-6-yl)prop-2-enamide (CAS 3077720-24-9) is a chemical compound with the molecular formula C17H13F3N4O and a molecular weight of 346.31 g/mol. IUPAC name: (Z)-2-fluoro-N-(5-fluoro-2,4-dimethyl-3-pyridinyl)-3-(7-fluoro-1H-indazol-6-yl)prop-2-enamide. InChIKey: IJHJJZPFBBSIBM-XGICHPGQSA-N.
| Molecular formula | C17H13F3N4O |
|---|---|
| Molecular weight | 346.31 g/mol |
| IUPAC name | (Z)-2-fluoro-N-(5-fluoro-2,4-dimethyl-3-pyridinyl)-3-(7-fluoro-1H-indazol-6-yl)prop-2-enamide |
| InChIKey | IJHJJZPFBBSIBM-XGICHPGQSA-N |
| SMILES | CC1=C(C(=NC=C1F)C)NC(=O)/C(=C/C2=C(C3=C(C=C2)C=NN3)F)/F |
Computed by PubChem (NCBI)