CAS 3078678-28-8 is the registry number for EGFR-IN-179. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[4-(furan-2-ylmethylamino)quinazolin-2-yl]amino]naphthalene-1-sulfonic acid (CAS 3078678-28-8) is a chemical compound with the molecular formula C23H18N4O4S and a molecular weight of 446.5 g/mol. IUPAC name: 2-[[4-(furan-2-ylmethylamino)quinazolin-2-yl]amino]naphthalene-1-sulfonic acid. InChIKey: PPAIOEQFKJNBPT-UHFFFAOYSA-N.
| Molecular formula | C23H18N4O4S |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | 2-[[4-(furan-2-ylmethylamino)quinazolin-2-yl]amino]naphthalene-1-sulfonic acid |
| InChIKey | PPAIOEQFKJNBPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2S(=O)(=O)O)NC3=NC4=CC=CC=C4C(=N3)NCC5=CC=CO5 |
Computed by PubChem (NCBI)