Products 3080315-83-6
CAS 3080315-83-6 is the registry number for GNE-5152. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3,4-difluorophenyl)-1-(6-pyridin-4-yl-3-pyridinyl)piperidin-2-one (CAS 3080315-83-6) is a chemical compound with the molecular formula C21H17F2N3O and a molecular weight of 365.4 g/mol. IUPAC name: 4-(3,4-difluorophenyl)-1-(6-pyridin-4-yl-3-pyridinyl)piperidin-2-one. InChIKey: MTYJYCVJJSTJCI-UHFFFAOYSA-N.
| Molecular formula | C21H17F2N3O |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 4-(3,4-difluorophenyl)-1-(6-pyridin-4-yl-3-pyridinyl)piperidin-2-one |
| InChIKey | MTYJYCVJJSTJCI-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CC1C2=CC(=C(C=C2)F)F)C3=CN=C(C=C3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)