CAS 3080624-02-5 is the registry number for N-(4-(Tert-butyl)phenyl)-N-(3-chlorophenyl)-[1,1'-biphenyl]-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(4-tert-butylphenyl)-N-(3-chlorophenyl)-2-phenylaniline (CAS 3080624-02-5) is a chemical compound with the molecular formula C28H26ClN and a molecular weight of 412.0 g/mol. IUPAC name: N-(4-tert-butylphenyl)-N-(3-chlorophenyl)-2-phenylaniline. InChIKey: RHHDPONIOKSDMV-UHFFFAOYSA-N.
| Molecular formula | C28H26ClN |
|---|---|
| Molecular weight | 412.0 g/mol |
| IUPAC name | N-(4-tert-butylphenyl)-N-(3-chlorophenyl)-2-phenylaniline |
| InChIKey | RHHDPONIOKSDMV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N(C2=CC(=CC=C2)Cl)C3=CC=CC=C3C4=CC=CC=C4 |
Computed by PubChem (NCBI)