CAS 308086-87-5 is the registry number for (E)–2–(((2–Aminophenyl)imino)methyl)–4,6–di–tert–butylphenol. Offered by: GLPBio. Available pack sizes: 1g.
2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol (CAS 308086-87-5) is a chemical compound with the molecular formula C21H28N2O and a molecular weight of 324.5 g/mol. IUPAC name: 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol. InChIKey: WOIXERHXLOOLRS-UHFFFAOYSA-N.
| Molecular formula | C21H28N2O |
|---|---|
| Molecular weight | 324.5 g/mol |
| IUPAC name | 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol |
| InChIKey | WOIXERHXLOOLRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)O)C=NC2=CC=CC=C2N |
Computed by PubChem (NCBI)