CAS 3080992-04-4 is the registry number for Antifungal agent 134. Offered by: MedChemExpress. Available pack sizes: Get quote.
N'-(4-fluorophenyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetohydrazide (CAS 3080992-04-4) is a chemical compound with the molecular formula C18H12F4N2O4 and a molecular weight of 396.3 g/mol. IUPAC name: N'-(4-fluorophenyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetohydrazide. InChIKey: LWOAFJSNTIHVPF-UHFFFAOYSA-N.
| Molecular formula | C18H12F4N2O4 |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | N'-(4-fluorophenyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetohydrazide |
| InChIKey | LWOAFJSNTIHVPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NNC(=O)COC2=CC3=C(C=C2)C(=CC(=O)O3)C(F)(F)F)F |
Computed by PubChem (NCBI)