CAS 308144-65-2 is the registry number for N-(4'-Bromo-[1,1'-biphenyl]-4-yl)-N-phenylnaphthalen-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-(4-bromophenyl)phenyl]-N-phenylnaphthalen-2-amine (CAS 308144-65-2) is a chemical compound with the molecular formula C28H20BrN and a molecular weight of 450.4 g/mol. IUPAC name: N-[4-(4-bromophenyl)phenyl]-N-phenylnaphthalen-2-amine. InChIKey: UZSPMHOOYSLXNZ-UHFFFAOYSA-N.
| Molecular formula | C28H20BrN |
|---|---|
| Molecular weight | 450.4 g/mol |
| IUPAC name | N-[4-(4-bromophenyl)phenyl]-N-phenylnaphthalen-2-amine |
| InChIKey | UZSPMHOOYSLXNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)C3=CC=C(C=C3)Br)C4=CC5=CC=CC=C5C=C4 |
Computed by PubChem (NCBI)