CAS 3081612-41-8 is the registry number for Lenalidomide-5-Br-amide-C2-Br. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propanamide (CAS 3081612-41-8) is a chemical compound with the molecular formula C16H16BrN3O4 and a molecular weight of 394.22 g/mol. IUPAC name: 3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propanamide. InChIKey: VYVNPQQUTJNPSQ-UHFFFAOYSA-N.
| Molecular formula | C16H16BrN3O4 |
|---|---|
| Molecular weight | 394.22 g/mol |
| IUPAC name | 3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propanamide |
| InChIKey | VYVNPQQUTJNPSQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)NC(=O)CCBr |
Computed by PubChem (NCBI)