CAS 3081687-67-1 is the registry number for P2Y14R antagonist 4. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-piperidin-4-ylphenyl)-5-[2-[4-(trifluoromethyl)phenyl]ethylsulfonylamino]benzoic acid (CAS 3081687-67-1) is a chemical compound with the molecular formula C27H27F3N2O4S and a molecular weight of 532.6 g/mol. IUPAC name: 3-(4-piperidin-4-ylphenyl)-5-[2-[4-(trifluoromethyl)phenyl]ethylsulfonylamino]benzoic acid. InChIKey: BWULCRKXQFZTPV-UHFFFAOYSA-N.
| Molecular formula | C27H27F3N2O4S |
|---|---|
| Molecular weight | 532.6 g/mol |
| IUPAC name | 3-(4-piperidin-4-ylphenyl)-5-[2-[4-(trifluoromethyl)phenyl]ethylsulfonylamino]benzoic acid |
| InChIKey | BWULCRKXQFZTPV-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC=C(C=C2)C3=CC(=CC(=C3)NS(=O)(=O)CCC4=CC=C(C=C4)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)