Products 3082344-46-2

CAS 3082344-46-2 is the registry number for Dopamine D4 receptor ligand 3. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

1-[3-(4-naphthalen-2-ylpiperazin-1-yl)propyl]-3,4-dihydroquinolin-2-one;oxalic acid (CAS 3082344-46-2) is a chemical compound with the molecular formula C28H31N3O5 and a molecular weight of 489.6 g/mol. IUPAC name: 1-[3-(4-naphthalen-2-ylpiperazin-1-yl)propyl]-3,4-dihydroquinolin-2-one;oxalic acid. InChIKey: XPFFAGRHVDEABW-UHFFFAOYSA-N.

Identity
Molecular formulaC28H31N3O5
Molecular weight489.6 g/mol
IUPAC name1-[3-(4-naphthalen-2-ylpiperazin-1-yl)propyl]-3,4-dihydroquinolin-2-one;oxalic acid
InChIKeyXPFFAGRHVDEABW-UHFFFAOYSA-N
SMILESC1CC(=O)N(C2=CC=CC=C21)CCCN3CCN(CC3)C4=CC5=CC=CC=C5C=C4.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)