Products 308293-08-5
CAS 308293-08-5 is the registry number for SARS-CoV-2-IN-120. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]naphthalene-1-carboxamide (CAS 308293-08-5) is a chemical compound with the molecular formula C21H18N4O3S2 and a molecular weight of 438.5 g/mol. IUPAC name: N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]naphthalene-1-carboxamide. InChIKey: HJZPZKJJQGFFBQ-UHFFFAOYSA-N.
| Molecular formula | C21H18N4O3S2 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]naphthalene-1-carboxamide |
| InChIKey | HJZPZKJJQGFFBQ-UHFFFAOYSA-N |
| SMILES | CCC1=NN=C(S1)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)