CAS 30833-12-6 appears in our catalog under these names: Ipratropium Bromide Impurity 28, Nortropine Impurity 1. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl (1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 30833-12-6) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: ethyl (1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: XSEAOCLJRXSRJQ-JVHMLUBASA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | ethyl (1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | XSEAOCLJRXSRJQ-JVHMLUBASA-N |
| SMILES | CCOC(=O)N1[C@@H]2CC[C@H]1CC(C2)O |
Computed by PubChem (NCBI)