CAS 308338-96-7 appears in our catalog under these names: P-Coumaric acid 4-o-sulfate disodium salt, 95%, p-Coumaric Acid 4-O-Sulfate Disodium Salt, >95% (HPLC), p-Coumaric acid 4-O-sulfate disodium. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 100mg, 250mg, 2,5g, 0,1g, 0,05g, 0,25g, 1g, 0,5g.
Disodium;(E)-3-(4-sulfonatooxyphenyl)prop-2-enoate (CAS 308338-96-7) is a chemical compound with the molecular formula C9H6Na2O6S and a molecular weight of 288.19 g/mol. IUPAC name: disodium;(E)-3-(4-sulfonatooxyphenyl)prop-2-enoate. InChIKey: ZBEAEMLBRSACIO-RRHCXGJISA-L.
| Molecular formula | C9H6Na2O6S |
|---|---|
| Molecular weight | 288.19 g/mol |
| IUPAC name | disodium;(E)-3-(4-sulfonatooxyphenyl)prop-2-enoate |
| InChIKey | ZBEAEMLBRSACIO-RRHCXGJISA-L |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)[O-])OS(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)