CAS 3083390-68-2 is the registry number for 2-(3-Fluorophenoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95+%. Offered by: Ambeed. Available pack sizes: 5g, 1g, 250mg.
2-(3-fluorophenoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 3083390-68-2) is a chemical compound with the molecular formula C17H19BFNO3 and a molecular weight of 315.1 g/mol. IUPAC name: 2-(3-fluorophenoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: BHDBVLZXTIHJDM-UHFFFAOYSA-N.
| Molecular formula | C17H19BFNO3 |
|---|---|
| Molecular weight | 315.1 g/mol |
| IUPAC name | 2-(3-fluorophenoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | BHDBVLZXTIHJDM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)OC3=CC(=CC=C3)F |
Computed by PubChem (NCBI)