CAS 30860-22-1 appears in our catalog under these names: 3-Chloro-2-norbornanone, 96%, 3-Chloro-2-norbornanone, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
(1S,3R,4R)-3-chlorobicyclo[2.2.1]heptan-2-one (CAS 30860-22-1) is a chemical compound with the molecular formula C7H9ClO and a molecular weight of 144.60 g/mol. IUPAC name: (1S,3R,4R)-3-chlorobicyclo[2.2.1]heptan-2-one. InChIKey: PQRKEKMZLKKQOP-NGJCXOISSA-N.
| Molecular formula | C7H9ClO |
|---|---|
| Molecular weight | 144.60 g/mol |
| IUPAC name | (1S,3R,4R)-3-chlorobicyclo[2.2.1]heptan-2-one |
| InChIKey | PQRKEKMZLKKQOP-NGJCXOISSA-N |
| SMILES | C1C[C@H]2C[C@@H]1[C@H](C2=O)Cl |
Computed by PubChem (NCBI)