CAS 3087-82-9 is the registry number for Cesium tetraphenylborate, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
Cesium tetraphenylboranuide (CAS 3087-82-9) is a chemical compound with the molecular formula C24H20BCs and a molecular weight of 452.1 g/mol. IUPAC name: cesium tetraphenylboranuide. InChIKey: UNGHRMDIEUCTPZ-UHFFFAOYSA-N.
| Molecular formula | C24H20BCs |
|---|---|
| Molecular weight | 452.1 g/mol |
| IUPAC name | cesium tetraphenylboranuide |
| InChIKey | UNGHRMDIEUCTPZ-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cs+] |
Computed by PubChem (NCBI)