CAS 3087062-50-5 is the registry number for hMAO-B-IN-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[3-nitro-5-[2-(trifluoromethyl)phenyl]thiophen-2-yl]thiochromen-4-one (CAS 3087062-50-5) is a chemical compound with the molecular formula C20H10F3NO3S2 and a molecular weight of 433.4 g/mol. IUPAC name: 3-[3-nitro-5-[2-(trifluoromethyl)phenyl]thiophen-2-yl]thiochromen-4-one. InChIKey: GYAUZTDTRDDHRH-UHFFFAOYSA-N.
| Molecular formula | C20H10F3NO3S2 |
|---|---|
| Molecular weight | 433.4 g/mol |
| IUPAC name | 3-[3-nitro-5-[2-(trifluoromethyl)phenyl]thiophen-2-yl]thiochromen-4-one |
| InChIKey | GYAUZTDTRDDHRH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=C(S2)C3=CSC4=CC=CC=C4C3=O)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)