CAS 30877-05-5 is the registry number for 2,3,6,7-Tetrafluoroanthracene-9,10-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 50mg, 1g.
2,3,6,7-tetrafluoroanthracene-9,10-dione (CAS 30877-05-5) is a chemical compound with the molecular formula C14H4F4O2 and a molecular weight of 280.17 g/mol. IUPAC name: 2,3,6,7-tetrafluoroanthracene-9,10-dione. InChIKey: WYPWRPJMICDWRZ-UHFFFAOYSA-N.
| Molecular formula | C14H4F4O2 |
|---|---|
| Molecular weight | 280.17 g/mol |
| IUPAC name | 2,3,6,7-tetrafluoroanthracene-9,10-dione |
| InChIKey | WYPWRPJMICDWRZ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)C(=O)C3=CC(=C(C=C3C2=O)F)F |
Computed by PubChem (NCBI)