Products 30877-05-5

CAS 30877-05-5 is the registry number for 2,3,6,7-Tetrafluoroanthracene-9,10-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 50mg, 1g.

Structural formula: {0} (CAS {1})

2,3,6,7-tetrafluoroanthracene-9,10-dione (CAS 30877-05-5) is a chemical compound with the molecular formula C14H4F4O2 and a molecular weight of 280.17 g/mol. IUPAC name: 2,3,6,7-tetrafluoroanthracene-9,10-dione. InChIKey: WYPWRPJMICDWRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H4F4O2
Molecular weight280.17 g/mol
IUPAC name2,3,6,7-tetrafluoroanthracene-9,10-dione
InChIKeyWYPWRPJMICDWRZ-UHFFFAOYSA-N
SMILESC1=C2C(=CC(=C1F)F)C(=O)C3=CC(=C(C=C3C2=O)F)F

Computed by PubChem (NCBI)