CAS 308796-29-4 is the registry number for 4-ETHOXYBENZYLZINC CHLORIDE, 0.5M SOLUT&. Offered by: Sigma-Aldrich. Available pack sizes: 50ML.
Chlorozinc(1+);1-ethoxy-4-methanidylbenzene (CAS 308796-29-4) is a chemical compound with the molecular formula C9H11ClOZn and a molecular weight of 236.0 g/mol. IUPAC name: chlorozinc(1+);1-ethoxy-4-methanidylbenzene. InChIKey: IHVIABSDZIDBFT-UHFFFAOYSA-M.
| Molecular formula | C9H11ClOZn |
|---|---|
| Molecular weight | 236.0 g/mol |
| IUPAC name | chlorozinc(1+);1-ethoxy-4-methanidylbenzene |
| InChIKey | IHVIABSDZIDBFT-UHFFFAOYSA-M |
| SMILES | CCOC1=CC=C(C=C1)[CH2-].Cl[Zn+] |
Computed by PubChem (NCBI)