CAS 3088543-72-7 is the registry number for PAC-Phe-Val. Offered by: MedChemExpress. Available pack sizes: Get quote.
Bis[3-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]amino]-2-benzyl-3-oxopropyl]phosphinic acid (CAS 3088543-72-7) is a chemical compound with the molecular formula C30H43N4O6P and a molecular weight of 586.7 g/mol. IUPAC name: bis[3-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]amino]-2-benzyl-3-oxopropyl]phosphinic acid. InChIKey: ILQHENQHTAGJDM-HDLCADABSA-N.
| Molecular formula | C30H43N4O6P |
|---|---|
| Molecular weight | 586.7 g/mol |
| IUPAC name | bis[3-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]amino]-2-benzyl-3-oxopropyl]phosphinic acid |
| InChIKey | ILQHENQHTAGJDM-HDLCADABSA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)C(CC1=CC=CC=C1)CP(=O)(CC(CC2=CC=CC=C2)C(=O)N[C@@H](C(C)C)C(=O)N)O |
Computed by PubChem (NCBI)