CAS 30897-25-7 appears in our catalog under these names: Fluphenazine N-Oxide, Fluphenazine Decanoate Impurity 15, Fluphenazine N4'-oxide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[1-oxido-4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-ium-1-yl]ethanol (CAS 30897-25-7) is a chemical compound with the molecular formula C22H26F3N3O2S and a molecular weight of 453.5 g/mol. IUPAC name: 2-[1-oxido-4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-ium-1-yl]ethanol. InChIKey: PBDWTDUDJVOBEV-UHFFFAOYSA-N.
| Molecular formula | C22H26F3N3O2S |
|---|---|
| Molecular weight | 453.5 g/mol |
| IUPAC name | 2-[1-oxido-4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-ium-1-yl]ethanol |
| InChIKey | PBDWTDUDJVOBEV-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCN1CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C(F)(F)F)(CCO)[O-] |
Computed by PubChem (NCBI)