CAS 309-11-5 is the registry number for (Pentafluoroethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1,1,2,2,2-pentafluoroethylbenzene (CAS 309-11-5) is a chemical compound with the molecular formula C8H5F5 and a molecular weight of 196.12 g/mol. IUPAC name: 1,1,2,2,2-pentafluoroethylbenzene. InChIKey: XYKZEZPREAUXDQ-UHFFFAOYSA-N.
| Molecular formula | C8H5F5 |
|---|---|
| Molecular weight | 196.12 g/mol |
| IUPAC name | 1,1,2,2,2-pentafluoroethylbenzene |
| InChIKey | XYKZEZPREAUXDQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)