CAS 30903-88-9 appears in our catalog under these names: Lithium tartrate, 98%, Lithium tartrate monohydrate, 95%, Lithium tartrate(x:1), 99%, Lithium Tartrate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 50g, 1kg, 500g, 100g, 25g, 250g.
Dilithium;(2R,3R)-2,3-dihydroxybutanedioate (CAS 30903-88-9) is a chemical compound with the molecular formula C4H4Li2O6 and a molecular weight of 162.0 g/mol. IUPAC name: dilithium;(2R,3R)-2,3-dihydroxybutanedioate. InChIKey: JCCYXJAEFHYHPP-OLXYHTOASA-L.
| Molecular formula | C4H4Li2O6 |
|---|---|
| Molecular weight | 162.0 g/mol |
| IUPAC name | dilithium;(2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | JCCYXJAEFHYHPP-OLXYHTOASA-L |
| SMILES | [Li+].[Li+].[C@@H]([C@H](C(=O)[O-])O)(C(=O)[O-])O |
Computed by PubChem (NCBI)