Products 3091879-31-8
CAS 3091879-31-8 appears in our catalog under these names: Cyanine 7 (free acid) (bromide), 96.22%, Cyanine 7, free acid. Offered by: MedChemExpress, Sigma-Aldrich. Available pack sizes: 1 mg, 5 mg, 10 mg, 10MG.
6-[3,3-dimethyl-2-[7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indol-1-yl]hexanoic acid bromide (CAS 3091879-31-8) is a chemical compound with the molecular formula C34H41BrN2O2 and a molecular weight of 589.6 g/mol. IUPAC name: 6-[3,3-dimethyl-2-[7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indol-1-yl]hexanoic acid bromide. InChIKey: RKXHPNBYTWSDKX-UHFFFAOYSA-N.
| Molecular formula | C34H41BrN2O2 |
|---|---|
| Molecular weight | 589.6 g/mol |
| IUPAC name | 6-[3,3-dimethyl-2-[7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indol-1-yl]hexanoic acid bromide |
| InChIKey | RKXHPNBYTWSDKX-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2[N+](=C1C=CC=CC=CC=C3C(C4=CC=CC=C4N3CCCCCC(=O)O)(C)C)C)C.[Br-] |
Computed by PubChem (NCBI)
Synonyms:
orb3136923