CAS 30925-07-6 appears in our catalog under these names: L-Cystine dihydrochloride, 98%, L-Cystine Dihydrochloride, >95% (HPLC), L-Cystine dihydrochloride/ 99.58% (existing batch purity), L–Cystine dihydrochloride, L-Cystine dihydrochloride, 99% . Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 500g, 1kg, 5g, 25g, 2,5g, 250mg, 500mg.
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;dihydrochloride (CAS 30925-07-6) is a chemical compound with the molecular formula C6H14Cl2N2O4S2 and a molecular weight of 313.2 g/mol. IUPAC name: (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;dihydrochloride. InChIKey: HHGZUQPEIHGQST-RGVONZFCSA-N.
| Molecular formula | C6H14Cl2N2O4S2 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;dihydrochloride |
| InChIKey | HHGZUQPEIHGQST-RGVONZFCSA-N |
| SMILES | C([C@@H](C(=O)O)N)SSC[C@@H](C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)