Products 309257-29-2
CAS 309257-29-2 is the registry number for 4-tert-Octylphenol-glucuronide, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.
(2S,3S,6S)-3,4,5-trihydroxy-6-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]oxane-2-carboxylic acid (CAS 309257-29-2) is a chemical compound with the molecular formula C20H30O7 and a molecular weight of 382.4 g/mol. IUPAC name: (2S,3S,6S)-3,4,5-trihydroxy-6-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]oxane-2-carboxylic acid. InChIKey: RUVXVZONPCIFDF-CLVQRLLRSA-N.
| Molecular formula | C20H30O7 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | (2S,3S,6S)-3,4,5-trihydroxy-6-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]oxane-2-carboxylic acid |
| InChIKey | RUVXVZONPCIFDF-CLVQRLLRSA-N |
| SMILES | CC(C)(C)CC(C)(C)C1=CC=C(C=C1)O[C@H]2C(C([C@@H]([C@H](O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)