CAS 309265-60-9 appears in our catalog under these names: 4,4,6,8-Tetramethyl-4,5-dihydro-1h-[1,2]dithiolo[3,4-c]quinoline-1-thione, 95%, 4,4,6,8-TEtramethyl-4,5-dihydro-1h-(1,2)dithiolo(3,4-c)quinoline-1-thione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4,4,6,8-tetramethyl-5H-dithiolo[3,4-c]quinoline-1-thione (CAS 309265-60-9) is a chemical compound with the molecular formula C14H15NS3 and a molecular weight of 293.5 g/mol. IUPAC name: 4,4,6,8-tetramethyl-5H-dithiolo[3,4-c]quinoline-1-thione. InChIKey: OCGSUULFZGILFI-UHFFFAOYSA-N.
| Molecular formula | C14H15NS3 |
|---|---|
| Molecular weight | 293.5 g/mol |
| IUPAC name | 4,4,6,8-tetramethyl-5H-dithiolo[3,4-c]quinoline-1-thione |
| InChIKey | OCGSUULFZGILFI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C3=C(C(N2)(C)C)SSC3=S)C |
Computed by PubChem (NCBI)