Products 3092660-74-4
CAS 3092660-74-4 appears in our catalog under these names: 6-Bromo-7-fluoro-1,3,3-trimethylindolin-2-one, 95%, 6-Bromo-7-fluoro-1,3,3-trimethylindolin-2-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
6-bromo-7-fluoro-1,3,3-trimethylindol-2-one (CAS 3092660-74-4) is a chemical compound with the molecular formula C11H11BrFNO and a molecular weight of 272.11 g/mol. IUPAC name: 6-bromo-7-fluoro-1,3,3-trimethylindol-2-one. InChIKey: GKROAZVSZSQVOL-UHFFFAOYSA-N.
| Molecular formula | C11H11BrFNO |
|---|---|
| Molecular weight | 272.11 g/mol |
| IUPAC name | 6-bromo-7-fluoro-1,3,3-trimethylindol-2-one |
| InChIKey | GKROAZVSZSQVOL-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=C(C=C2)Br)F)N(C1=O)C)C |
Computed by PubChem (NCBI)