CAS 309271-94-1 appears in our catalog under these names: 1-Butanone, 1-(10H-phenothiazin-10-yl)-2-(5H-1,2,4-triazino[5,6-b]indol-3-ylthio)-, 98%, Inauhzin, 95%, Inauhzin, Inauhzin/ 97.69% (existing batch purity), Inauhzin 98%. Offered by: Fluorochem, Combi-blocks, GLPBio, TargetMol, Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 2mg, 10mM (in 1ml dmso).
1-phenothiazin-10-yl-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butan-1-one (CAS 309271-94-1) is a chemical compound with the molecular formula C25H19N5OS2 and a molecular weight of 469.6 g/mol. IUPAC name: 1-phenothiazin-10-yl-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butan-1-one. InChIKey: VHUOXERIKQWIJE-UHFFFAOYSA-N.
| Molecular formula | C25H19N5OS2 |
|---|---|
| Molecular weight | 469.6 g/mol |
| IUPAC name | 1-phenothiazin-10-yl-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butan-1-one |
| InChIKey | VHUOXERIKQWIJE-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)N1C2=CC=CC=C2SC3=CC=CC=C31)SC4=NC5=C(C6=CC=CC=C6N5)N=N4 |
Computed by PubChem (NCBI)