Products 309762-22-9
CAS 309762-22-9 is the registry number for Betaine-13C3, 99.86%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2-[tri((113C)methyl)azaniumyl]acetate (CAS 309762-22-9) is a chemical compound with the molecular formula C5H11NO2 and a molecular weight of 120.12 g/mol. IUPAC name: 2-[tri((113C)methyl)azaniumyl]acetate. InChIKey: KWIUHFFTVRNATP-VMIGTVKRSA-N.
| Molecular formula | C5H11NO2 |
|---|---|
| Molecular weight | 120.12 g/mol |
| IUPAC name | 2-[tri((113C)methyl)azaniumyl]acetate |
| InChIKey | KWIUHFFTVRNATP-VMIGTVKRSA-N |
| SMILES | [13CH3][N+]([13CH3])([13CH3])CC(=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Betaine-13C3, orb3138854