CAS 3098883-91-8 is the registry number for MAO-B-IN-49. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[8-[(3,4-difluorophenyl)methoxy]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]propanamide (CAS 3098883-91-8) is a chemical compound with the molecular formula C19H20F2N2O3 and a molecular weight of 362.4 g/mol. IUPAC name: (2S)-2-[8-[(3,4-difluorophenyl)methoxy]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]propanamide. InChIKey: JBPBSHDGLRWBKX-LBPRGKRZSA-N.
| Molecular formula | C19H20F2N2O3 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (2S)-2-[8-[(3,4-difluorophenyl)methoxy]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]propanamide |
| InChIKey | JBPBSHDGLRWBKX-LBPRGKRZSA-N |
| SMILES | C[C@@H](C(=O)N)N1CCOC2=C(C1)C=CC(=C2)OCC3=CC(=C(C=C3)F)F |
Computed by PubChem (NCBI)