CAS 30992-68-8 is the registry number for 6-Benzyloxy Warfarin. Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.
4-hydroxy-3-(3-oxo-1-phenylbutyl)-6-phenylmethoxychromen-2-one (CAS 30992-68-8) is a chemical compound with the molecular formula C26H22O5 and a molecular weight of 414.4 g/mol. IUPAC name: 4-hydroxy-3-(3-oxo-1-phenylbutyl)-6-phenylmethoxychromen-2-one. InChIKey: ZYPCRNWFEICXBH-UHFFFAOYSA-N.
| Molecular formula | C26H22O5 |
|---|---|
| Molecular weight | 414.4 g/mol |
| IUPAC name | 4-hydroxy-3-(3-oxo-1-phenylbutyl)-6-phenylmethoxychromen-2-one |
| InChIKey | ZYPCRNWFEICXBH-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C1=CC=CC=C1)C2=C(C3=C(C=CC(=C3)OCC4=CC=CC=C4)OC2=O)O |
Computed by PubChem (NCBI)