Products 309959-34-0
CAS 309959-34-0 is the registry number for ABT-202. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R)-1-pyridin-3-ylpyrrolidin-3-amine (CAS 309959-34-0) is a chemical compound with the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. IUPAC name: (3R)-1-pyridin-3-ylpyrrolidin-3-amine. InChIKey: LVGMMVAWLISWJD-MRVPVSSYSA-N.
| Molecular formula | C9H13N3 |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | (3R)-1-pyridin-3-ylpyrrolidin-3-amine |
| InChIKey | LVGMMVAWLISWJD-MRVPVSSYSA-N |
| SMILES | C1CN(C[C@@H]1N)C2=CN=CC=C2 |
Computed by PubChem (NCBI)