CAS 31039-74-4 is the registry number for N-phenyltetrachlorophthalimide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5,6,7-tetrachloro-2-phenylisoindole-1,3-dione (CAS 31039-74-4) is a chemical compound with the molecular formula C14H5Cl4NO2 and a molecular weight of 361.0 g/mol. IUPAC name: 4,5,6,7-tetrachloro-2-phenylisoindole-1,3-dione. InChIKey: LPTOKNBNQSVVQO-UHFFFAOYSA-N.
| Molecular formula | C14H5Cl4NO2 |
|---|---|
| Molecular weight | 361.0 g/mol |
| IUPAC name | 4,5,6,7-tetrachloro-2-phenylisoindole-1,3-dione |
| InChIKey | LPTOKNBNQSVVQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=C(C2=O)C(=C(C(=C3Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)