CAS 310452-23-4 is the registry number for 2-Difluoromethanesulfonyl-1,4-dimethylbenzene, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(difluoromethylsulfonyl)-1,4-dimethylbenzene (CAS 310452-23-4) is a chemical compound with the molecular formula C9H10F2O2S and a molecular weight of 220.24 g/mol. IUPAC name: 2-(difluoromethylsulfonyl)-1,4-dimethylbenzene. InChIKey: OXAFRBYZAGHGRQ-UHFFFAOYSA-N.
| Molecular formula | C9H10F2O2S |
|---|---|
| Molecular weight | 220.24 g/mol |
| IUPAC name | 2-(difluoromethylsulfonyl)-1,4-dimethylbenzene |
| InChIKey | OXAFRBYZAGHGRQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)C(F)F |
Computed by PubChem (NCBI)