CAS 3107-98-0 appears in our catalog under these names: Dimethyloctafluoroadipate, 98%, 98%, Dimethyl octafluoroadipate, 98%, Dimethyl octafluoroadipate, 97%, Dimethyl Octafluoroadipate, Dimethyl Octafluoroadipate, >97.0%(GC). Offered by: Chemat, Fluorochem, Ambeed, Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 0,025kg.
Dimethyl 2,2,3,3,4,4,5,5-octafluorohexanedioate (CAS 3107-98-0) is a chemical compound with the molecular formula C8H6F8O4 and a molecular weight of 318.12 g/mol. IUPAC name: dimethyl 2,2,3,3,4,4,5,5-octafluorohexanedioate. InChIKey: XPXVIIILXUOEQA-UHFFFAOYSA-N.
| Molecular formula | C8H6F8O4 |
|---|---|
| Molecular weight | 318.12 g/mol |
| IUPAC name | dimethyl 2,2,3,3,4,4,5,5-octafluorohexanedioate |
| InChIKey | XPXVIIILXUOEQA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C(C(C(=O)OC)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)