CAS 31079-87-5 appears in our catalog under these names: (2R,3S,4R,5R)–2–(benzyloxy)–4,5–dihydroxytetrahydro–2H–pyran–3–yl 4–methylbenzenesulfonate, Benzyl 2-O-tosyl-β-D-arabinopyranoside. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 2g, 500mg, 5g.
[(2R,3S,4R,5R)-4,5-dihydroxy-2-phenylmethoxyoxan-3-yl] 4-methylbenzenesulfonate (CAS 31079-87-5) is a chemical compound with the molecular formula C19H22O7S and a molecular weight of 394.4 g/mol. IUPAC name: [(2R,3S,4R,5R)-4,5-dihydroxy-2-phenylmethoxyoxan-3-yl] 4-methylbenzenesulfonate. InChIKey: BCCUYJAJLVFEBJ-AKHDSKFASA-N.
| Molecular formula | C19H22O7S |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-4,5-dihydroxy-2-phenylmethoxyoxan-3-yl] 4-methylbenzenesulfonate |
| InChIKey | BCCUYJAJLVFEBJ-AKHDSKFASA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O[C@H]2[C@@H]([C@@H](CO[C@H]2OCC3=CC=CC=C3)O)O |
Computed by PubChem (NCBI)