CAS 3109-63-5 appears in our catalog under these names: Tetrabutylammonium hexafluorophosphate, >95% (HPLC), Tetrabutylammonium hexafluorophosphate(V), Tetra-n-butylammonium hexafluorophosphate, 98% , Tetrabutylammonium hexafluorophosphate, Tetrabutylammonium Hexafluorophosphate, >98.0%(T). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 10g, 5g, 500g, 25g, 100g, 1kg, 0,5kg, 250g.
Tetrabutylazanium hexafluorophosphate (CAS 3109-63-5) is a chemical compound with the molecular formula C16H36F6NP and a molecular weight of 387.43 g/mol. IUPAC name: tetrabutylazanium hexafluorophosphate. InChIKey: BKBKEFQIOUYLBC-UHFFFAOYSA-N.
| Molecular formula | C16H36F6NP |
|---|---|
| Molecular weight | 387.43 g/mol |
| IUPAC name | tetrabutylazanium hexafluorophosphate |
| InChIKey | BKBKEFQIOUYLBC-UHFFFAOYSA-N |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)