Products 3109123-46-5
CAS 3109123-46-5 is the registry number for NB-3. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 10 mg, 5 mg.
1-methyl-1-[(1S)-1-pyridin-4-ylethyl]-3-(2,2,2-trifluoroethyl)urea (CAS 3109123-46-5) is a chemical compound with the molecular formula C11H14F3N3O and a molecular weight of 261.24 g/mol. IUPAC name: 1-methyl-1-[(1S)-1-pyridin-4-ylethyl]-3-(2,2,2-trifluoroethyl)urea. InChIKey: NRMCGEBVBUWHHL-QMMMGPOBSA-N.
| Molecular formula | C11H14F3N3O |
|---|---|
| Molecular weight | 261.24 g/mol |
| IUPAC name | 1-methyl-1-[(1S)-1-pyridin-4-ylethyl]-3-(2,2,2-trifluoroethyl)urea |
| InChIKey | NRMCGEBVBUWHHL-QMMMGPOBSA-N |
| SMILES | C[C@@H](C1=CC=NC=C1)N(C)C(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)