CAS 31098-20-1 appears in our catalog under these names: Potassium 3-(acryloyloxy)propane-1-sulfonate 98%, Potassium 3-sulphonatopropyl acrylate, 98%, 3–Sulfopropyl acrylate potassium salt, Potassium 3-sulphonatopropyl acrylate, 3-Sulfopropyl Acrylate Potassium Salt, >98.0%(T). Offered by: Ambeed, Combi-blocks, GLPBio, Biosynth, TCI. Available pack sizes: 10g, 25g, 100g, 500g, 1g, 5g, 0,05kg, 0,1kg.
Potassium 3-prop-2-enoyloxypropane-1-sulfonate (CAS 31098-20-1) is a chemical compound with the molecular formula C6H9KO5S and a molecular weight of 232.30 g/mol. IUPAC name: potassium 3-prop-2-enoyloxypropane-1-sulfonate. InChIKey: VSFOXJWBPGONDR-UHFFFAOYSA-M.
| Molecular formula | C6H9KO5S |
|---|---|
| Molecular weight | 232.30 g/mol |
| IUPAC name | potassium 3-prop-2-enoyloxypropane-1-sulfonate |
| InChIKey | VSFOXJWBPGONDR-UHFFFAOYSA-M |
| SMILES | C=CC(=O)OCCCS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)