CAS 31098-21-2 appears in our catalog under these names: 3-Sulfopropyl methacrylate potassium salt, 97%, 3–Sulfopropyl methacrylate potassium salt, 3-Sulfopropyl methacrylate potassium, 3-Sulfopropyl Methacrylate Potassium Salt, >97.0%(HPLC)(T), 3-Sulfopropyl Methacrylate Potassium Salt 97%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5g, 100g, 25g, 1g, 500g, 0,025kg, 0,01kg, 1000g.
Potassium 3-(2-methylprop-2-enoyloxy)propane-1-sulfonate (CAS 31098-21-2) is a chemical compound with the molecular formula C7H11KO5S and a molecular weight of 246.32 g/mol. IUPAC name: potassium 3-(2-methylprop-2-enoyloxy)propane-1-sulfonate. InChIKey: PNOXUQIZPBURMT-UHFFFAOYSA-M.
| Molecular formula | C7H11KO5S |
|---|---|
| Molecular weight | 246.32 g/mol |
| IUPAC name | potassium 3-(2-methylprop-2-enoyloxy)propane-1-sulfonate |
| InChIKey | PNOXUQIZPBURMT-UHFFFAOYSA-M |
| SMILES | CC(=C)C(=O)OCCCS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)