CAS 3111776-36-1 is the registry number for TRIM25 ligand-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-1-[4-(3-methyl-4-phenylbenzoyl)-1,4-diazepan-1-yl]ethanone (CAS 3111776-36-1) is a chemical compound with the molecular formula C21H23ClN2O2 and a molecular weight of 370.9 g/mol. IUPAC name: 2-chloro-1-[4-(3-methyl-4-phenylbenzoyl)-1,4-diazepan-1-yl]ethanone. InChIKey: ORNHKPXIUAOCRQ-UHFFFAOYSA-N.
| Molecular formula | C21H23ClN2O2 |
|---|---|
| Molecular weight | 370.9 g/mol |
| IUPAC name | 2-chloro-1-[4-(3-methyl-4-phenylbenzoyl)-1,4-diazepan-1-yl]ethanone |
| InChIKey | ORNHKPXIUAOCRQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)N2CCCN(CC2)C(=O)CCl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)