CAS 31119-77-4 is the registry number for Cupric citrate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
Copper;2-hydroxypropane-1,2,3-tricarboxylic acid (CAS 31119-77-4) is a chemical compound with the molecular formula C6H8Cu2O7 and a molecular weight of 319.22 g/mol. IUPAC name: copper;2-hydroxypropane-1,2,3-tricarboxylic acid. InChIKey: OUJQALUYGBUJBS-UHFFFAOYSA-N.
| Molecular formula | C6H8Cu2O7 |
|---|---|
| Molecular weight | 319.22 g/mol |
| IUPAC name | copper;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChIKey | OUJQALUYGBUJBS-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.[Cu].[Cu] |
Computed by PubChem (NCBI)