CAS 3112-74-1 appears in our catalog under these names: Copper Dipropanoate, >95% (HPLC), Copper(II) propionate 98%, Copper Dipropanoate, 98%, 98%. Offered by: TRC, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg.
Copper propanoate (CAS 3112-74-1) is a chemical compound with the molecular formula C6H10CuO4 and a molecular weight of 209.69 g/mol. IUPAC name: copper propanoate. InChIKey: LZJJVTQGPPWQFS-UHFFFAOYSA-L.
| Molecular formula | C6H10CuO4 |
|---|---|
| Molecular weight | 209.69 g/mol |
| IUPAC name | copper propanoate |
| InChIKey | LZJJVTQGPPWQFS-UHFFFAOYSA-L |
| SMILES | CCC(=O)[O-].CCC(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)