CAS 31122-84-6 is the registry number for Lobitridol Impurity 7. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
5-acetamido-1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-1-N,3-N-dimethylbenzene-1,3-dicarboxamide (CAS 31122-84-6) is a chemical compound with the molecular formula C18H24I3N3O7 and a molecular weight of 775.1 g/mol. IUPAC name: 5-acetamido-1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-1-N,3-N-dimethylbenzene-1,3-dicarboxamide. InChIKey: RSBZNKFYPLBYBR-UHFFFAOYSA-N.
| Molecular formula | C18H24I3N3O7 |
|---|---|
| Molecular weight | 775.1 g/mol |
| IUPAC name | 5-acetamido-1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-1-N,3-N-dimethylbenzene-1,3-dicarboxamide |
| InChIKey | RSBZNKFYPLBYBR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=C(C(=C1I)C(=O)N(C)CC(CO)O)I)C(=O)N(C)CC(CO)O)I |
Computed by PubChem (NCBI)