CAS 311346-69-7 is the registry number for Ethyl 4-chloro-5,7-difluoroquinoline-3-carboxylate, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 250mg, 5g, 1g.
Ethyl 4-chloro-5,7-difluoroquinoline-3-carboxylate (CAS 311346-69-7) is a chemical compound with the molecular formula C12H8ClF2NO2 and a molecular weight of 271.64 g/mol. IUPAC name: ethyl 4-chloro-5,7-difluoroquinoline-3-carboxylate. InChIKey: IEGYWXRVOVIAMV-UHFFFAOYSA-N.
| Molecular formula | C12H8ClF2NO2 |
|---|---|
| Molecular weight | 271.64 g/mol |
| IUPAC name | ethyl 4-chloro-5,7-difluoroquinoline-3-carboxylate |
| InChIKey | IEGYWXRVOVIAMV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C=C(C=C(C2=C1Cl)F)F |
Computed by PubChem (NCBI)