CAS 311351-26-5 is the registry number for Nor-PE 2I. Offered by: TRC. Available pack sizes: 50mg.
(1R,2S,3S,5S)-8-(3-iodoprop-2-enyl)-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylic acid (CAS 311351-26-5) is a chemical compound with the molecular formula C18H22INO2 and a molecular weight of 411.3 g/mol. IUPAC name: (1R,2S,3S,5S)-8-(3-iodoprop-2-enyl)-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylic acid. InChIKey: XVDZDVGZYIHARA-HZMVEIRTSA-N.
| Molecular formula | C18H22INO2 |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | (1R,2S,3S,5S)-8-(3-iodoprop-2-enyl)-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylic acid |
| InChIKey | XVDZDVGZYIHARA-HZMVEIRTSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H]2C[C@@H]3CC[C@H]([C@H]2C(=O)O)N3CC=CI |
Computed by PubChem (NCBI)